C28H22F3N3O — CID 135131768
(6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131768) has the molecular formula C28H22F3N3O and a molecular weight of 473.50 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131768 |
| Molecular Formula | C28H22F3N3O |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-phenyl-2-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccc(C(F)(F)F)cc4)nc(-c4ccccc4)c3CC[C@H]12 |
| InChI | InChI=1S/C28H22F3N3O/c1-16-22-13-12-21-23(17-6-4-3-5-7-17)33-26(18-8-10-20(11-9-18)28(29,30)31)34-25(21)27(22,2)14-19(15-32)24(16)35/h3-11,14,16,22H,12-13H2,1-2H3/t16-,22-,27-/m1/s1 |
| InChIKey | LFWQSHMAYGLOOG-KRLBWHOLSA-N |
| XLogP | 6.32 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |