C29H29FN4O — CID 135131773
(6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[(1E)-1-(2-methyliminocyclopentylidene)ethyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131773) has the molecular formula C29H29FN4O and a molecular weight of 468.58 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[(1E)-1-(2-methyliminocyclopentylidene)ethyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[(1E)-1-(2-methyliminocyclopentylidene)ethyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131773 |
| Molecular Formula | C29H29FN4O |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (6aR,7R,10aS)-4-(2-fluorophenyl)-7,10a-dimethyl-2-[(1E)-1-(2-methyliminocyclopentylidene)ethyl]-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C/N=C1\CCC\C1=C(\C)c1nc(-c2ccccc2F)c2c(n1)[C@]1(C)C=C(C#N)C(=O)[C@H](C)[C@H]1CC2 |
| InChI | InChI=1S/C29H29FN4O/c1-16(19-9-7-11-24(19)32-4)28-33-25(20-8-5-6-10-23(20)30)21-12-13-22-17(2)26(35)18(15-31)14-29(22,3)27(21)34-28/h5-6,8,10,14,17,22H,7,9,11-13H2,1-4H3/b19-16+,32-24+/t17-,22-,29-/m1/s1 |
| InChIKey | VKYVNAXMHOBOIL-VLFPDSKLSA-N |
| XLogP | 5.80 |
| TPSA | 79.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|