C28H26N4O — CID 135131791
(1S,11R,12R)-1,12-dimethyl-4-(2-methyl-4-pyridinyl)-13-oxo-6-phenyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-2,4,6,14-tetraene-14-carbonitrile (PubChem CID 135131791) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is (1S,11R,12R)-1,12-dimethyl-4-(2-methyl-4-pyridinyl)-13-oxo-6-phenyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-2,4,6,14-tetraene-14-carbonitrile.
| Compound Name | (1S,11R,12R)-1,12-dimethyl-4-(2-methyl-4-pyridinyl)-13-oxo-6-phenyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-2,4,6,14-tetraene-14-carbonitrile |
|---|---|
| PubChem CID | 135131791 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (1S,11R,12R)-1,12-dimethyl-4-(2-methyl-4-pyridinyl)-13-oxo-6-phenyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-2,4,6,14-tetraene-14-carbonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CCC3)ccn1 |
| InChI | InChI=1S/C28H26N4O/c1-17-14-20(12-13-30-17)27-31-24(19-8-5-4-6-9-19)22-10-7-11-23-18(2)25(33)21(16-29)15-28(23,3)26(22)32-27/h4-6,8-9,12-15,18,23H,7,10-11H2,1-3H3/t18-,23-,28-/m1/s1 |
| InChIKey | SULRFWSPUNFDAD-GSDGAUQMSA-N |
| XLogP | 5.39 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |