C27H21F3N4O — CID 135131818
(6aR,7R,10aS)-7,10a-dimethyl-8-oxo-2-pyridin-4-yl-4-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131818) has the molecular formula C27H21F3N4O and a molecular weight of 474.49 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-2-pyridin-4-yl-4-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-2-pyridin-4-yl-4-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131818 |
| Molecular Formula | C27H21F3N4O |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-2-pyridin-4-yl-4-[4-(trifluoromethyl)phenyl]-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccncc4)nc(-c4ccc(C(F)(F)F)cc4)c3CC[C@H]12 |
| InChI | InChI=1S/C27H21F3N4O/c1-15-21-8-7-20-22(16-3-5-19(6-4-16)27(28,29)30)33-25(17-9-11-32-12-10-17)34-24(20)26(21,2)13-18(14-31)23(15)35/h3-6,9-13,15,21H,7-8H2,1-2H3/t15-,21-,26-/m1/s1 |
| InChIKey | RAAWUHZQEDJQMT-MDGPWXEQSA-N |
| XLogP | 5.71 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |