C22H22N4O3 — CID 135131823
(6aR,7R,10aS)-4-methoxy-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131823) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (6aR,7R,10aS)-4-methoxy-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-4-methoxy-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131823 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (6aR,7R,10aS)-4-methoxy-2-(2-methoxy-4-pyridinyl)-7,10a-dimethyl-8-oxo-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | COc1cc(-c2nc(OC)c3c(n2)[C@]2(C)C=C(C#N)C(=O)[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C22H22N4O3/c1-12-16-6-5-15-19(22(16,2)10-14(11-23)18(12)27)25-20(26-21(15)29-4)13-7-8-24-17(9-13)28-3/h7-10,12,16H,5-6H2,1-4H3/t12-,16-,22-/m1/s1 |
| InChIKey | NQHPXACATSADTK-DTJNWYTMSA-N |
| XLogP | 3.04 |
| TPSA | 97.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |