C25H31FN4O — CID 135131859
(6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 135131859) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 135131859 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | (6aR,7R,10aR)-4-(2-fluorophenyl)-7,10a-dimethyl-2-(4-methylpiperazin-1-yl)-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)c3nc(N4CCN(C)CC4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C25H31FN4O/c1-16-19-9-8-18-22(17-6-4-5-7-20(17)26)27-24(30-14-12-29(3)13-15-30)28-23(18)25(19,2)11-10-21(16)31/h4-7,16,19H,8-15H2,1-3H3/t16-,19-,25-/m1/s1 |
| InChIKey | CAWKTXQMTFNJOW-DNHRDODTSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |