C26H24N4O — CID 135131916
(6aR,7R,10aR)-7,10a-dimethyl-8-oxo-4-phenyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131916) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is (6aR,7R,10aR)-7,10a-dimethyl-8-oxo-4-phenyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-7,10a-dimethyl-8-oxo-4-phenyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131916 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (6aR,7R,10aR)-7,10a-dimethyl-8-oxo-4-phenyl-2-pyridin-4-yl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)C[C@@]2(C)c3nc(-c4ccncc4)nc(-c4ccccc4)c3CC[C@H]12 |
| InChI | InChI=1S/C26H24N4O/c1-16-21-9-8-20-22(17-6-4-3-5-7-17)29-25(18-10-12-28-13-11-18)30-24(20)26(21,2)14-19(15-27)23(16)31/h3-7,10-13,16,19,21H,8-9,14H2,1-2H3/t16-,19?,21-,26-/m1/s1 |
| InChIKey | OICMFBDCWQJWSR-YJCOFZCGSA-N |
| XLogP | 4.77 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|