C25H21N5O — CID 135131962
(6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyridin-3-yl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135131962) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyridin-3-yl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyridin-3-yl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135131962 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (6aR,7R,10aS)-7,10a-dimethyl-8-oxo-4-pyridin-3-yl-2-pyridin-4-yl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(C)c3nc(-c4ccncc4)nc(-c4cccnc4)c3CC[C@H]12 |
| InChI | InChI=1S/C25H21N5O/c1-15-20-6-5-19-21(17-4-3-9-28-14-17)29-24(16-7-10-27-11-8-16)30-23(19)25(20,2)12-18(13-26)22(15)31/h3-4,7-12,14-15,20H,5-6H2,1-2H3/t15-,20-,25-/m1/s1 |
| InChIKey | BJNSZKFTGDPQJX-LVJZWUNYSA-N |
| XLogP | 4.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |