C28H30FN3O2 — CID 135132129
(6aR,7R,10aR)-4-cyclopentyloxy-2-(8-fluoroquinolin-4-yl)-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one (PubChem CID 135132129) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-cyclopentyloxy-2-(8-fluoroquinolin-4-yl)-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one.
| Compound Name | (6aR,7R,10aR)-4-cyclopentyloxy-2-(8-fluoroquinolin-4-yl)-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
|---|---|
| PubChem CID | 135132129 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (6aR,7R,10aR)-4-cyclopentyloxy-2-(8-fluoroquinolin-4-yl)-7,10a-dimethyl-5,6,6a,7,9,10-hexahydrobenzo[h]quinazolin-8-one |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)c3nc(-c4ccnc5c(F)cccc45)nc(OC4CCCC4)c3CC[C@H]12 |
| InChI | InChI=1S/C28H30FN3O2/c1-16-21-11-10-20-25(28(21,2)14-12-23(16)33)31-26(32-27(20)34-17-6-3-4-7-17)19-13-15-30-24-18(19)8-5-9-22(24)29/h5,8-9,13,15-17,21H,3-4,6-7,10-12,14H2,1-2H3/t16-,21-,28-/m1/s1 |
| InChIKey | QIKUSIJBXKFQEI-MOFFZTGCSA-N |
| XLogP | 5.97 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |