C21H22N4O — CID 135132151
(6aR,7R,11aR)-7,11a-dimethyl-4-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-amine (PubChem CID 135132151) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (6aR,7R,11aR)-7,11a-dimethyl-4-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-amine.
| Compound Name | (6aR,7R,11aR)-7,11a-dimethyl-4-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 135132151 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (6aR,7R,11aR)-7,11a-dimethyl-4-phenyl-6,6a,7,11-tetrahydro-5H-[1,2]benzoxazolo[6,5-h]quinazolin-2-amine |
| SMILES | C[C@H]1c2oncc2C[C@@]2(C)c3nc(N)nc(-c4ccccc4)c3CC[C@H]12 |
| InChI | InChI=1S/C21H22N4O/c1-12-16-9-8-15-17(13-6-4-3-5-7-13)24-20(22)25-19(15)21(16,2)10-14-11-23-26-18(12)14/h3-7,11-12,16H,8-10H2,1-2H3,(H2,22,24,25)/t12-,16-,21-/m1/s1 |
| InChIKey | PLIJMEQEULIVJM-YDZGXFTCSA-N |
| XLogP | 3.89 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |