C27H25FN4O — CID 135132157
(6aR,7R,10aR)-4-(4-fluorophenyl)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 135132157) has the molecular formula C27H25FN4O and a molecular weight of 440.52 g/mol. Its IUPAC name is (6aR,7R,10aR)-4-(4-fluorophenyl)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aR)-4-(4-fluorophenyl)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 135132157 |
| Molecular Formula | C27H25FN4O |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (6aR,7R,10aR)-4-(4-fluorophenyl)-7,10a-dimethyl-2-(2-methyl-4-pyridinyl)-8-oxo-5,6,6a,7,9,10-hexahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccc(F)cc3)c3c(n2)[C@]2(C)CC(C#N)C(=O)[C@H](C)[C@H]2CC3)ccn1 |
| InChI | InChI=1S/C27H25FN4O/c1-15-12-18(10-11-30-15)26-31-23(17-4-6-20(28)7-5-17)21-8-9-22-16(2)24(33)19(14-29)13-27(22,3)25(21)32-26/h4-7,10-12,16,19,22H,8-9,13H2,1-3H3/t16-,19?,22-,27-/m1/s1 |
| InChIKey | LNCCPNVKXMXVRD-BRLBNAAPSA-N |
| XLogP | 5.22 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|