About 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid
1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 135132305) has the molecular formula C16H13F3N2O3
and a molecular weight of 338.29 g/mol. Its IUPAC name is 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| PubChem CID | 135132305 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | COC1CC=Cc2c1cccc2-n1ncc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O3/c1-24-13-7-3-4-9-10(13)5-2-6-12(9)21-14(16(17,18)19)11(8-20-21)15(22)23/h2-6,8,13H,7H2,1H3,(H,22,23) |
| InChIKey | RPVILAROWBDTDA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CID 135132305) is 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid is COC1CC=Cc2c1cccc2-n1ncc(C(=O)O)c1C(F)(F)F.
What is the InChIKey of 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid?
The InChIKey is RPVILAROWBDTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O3/c1-24-13-7-3-4-9-10(13)5-2-6-12(9)21-14(16(17,18)19)11(8-20-21)15(22)23/h2-6,8,13H,7H2,1H3,(H,22,23).
What are the key properties of 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid?
1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid has a molecular weight of 338.29 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-5,6-dihydronaphthalen-1-yl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 135132305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).