C19H18N2O5 — CID 135132388
4-[2-[(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxy]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 135132388) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 4-[2-[(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxy]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[2-[(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxy]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 135132388 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-[2-[(1-hydroxy-3-oxo-1H-isoindol-2-yl)oxy]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1CCON1C(=O)c2ccccc2C1O |
| InChI | InChI=1S/C19H18N2O5/c22-16-12-3-1-2-4-13(12)17(23)21(16)26-8-7-20-18(24)14-10-5-6-11(9-10)15(14)19(20)25/h1-6,10-11,14-16,22H,7-9H2 |
| InChIKey | VBAUFFCZWKYWBI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|