About N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide
N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide (PubChem CID 135132631) has the molecular formula C15H13NO5
and a molecular weight of 287.27 g/mol. Its IUPAC name is N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide.
Molecular Properties
| Compound Name | N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide |
| PubChem CID | 135132631 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide |
| SMILES | CCC(=O)Nc1c2ccoc2c(OC)c2oc(=O)ccc12 |
| InChI | InChI=1S/C15H13NO5/c1-3-10(17)16-12-8-4-5-11(18)21-14(8)15(19-2)13-9(12)6-7-20-13/h4-7H,3H2,1-2H3,(H,16,17) |
| InChIKey | KSMIOQTYROSRJX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide?
The IUPAC name of N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide (CID 135132631) is N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide.
What is the SMILES notation for N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide?
The canonical SMILES for N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide is CCC(=O)Nc1c2ccoc2c(OC)c2oc(=O)ccc12.
What is the InChIKey of N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide?
The InChIKey is KSMIOQTYROSRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO5/c1-3-10(17)16-12-8-4-5-11(18)21-14(8)15(19-2)13-9(12)6-7-20-13/h4-7H,3H2,1-2H3,(H,16,17).
What are the key properties of N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide?
N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide has a molecular weight of 287.27 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9-methoxy-7-oxofuro[3,2-g]chromen-4-yl)propanamide is sourced from PubChem (CID 135132631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).