About (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine
(2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine (PubChem CID 135132830) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine.
Molecular Properties
| Compound Name | (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine |
| PubChem CID | 135132830 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine |
| SMILES | CC[C@@H](OC)[C@H](N)Cc1cscn1 |
| InChI | InChI=1S/C9H16N2OS/c1-3-9(12-2)8(10)4-7-5-13-6-11-7/h5-6,8-9H,3-4,10H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | SGODPHDIVSDZRQ-RKDXNWHRSA-N |
| XLogP | 1.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine?
The IUPAC name of (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine (CID 135132830) is (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine.
What is the SMILES notation for (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine?
The canonical SMILES for (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine is CC[C@@H](OC)[C@H](N)Cc1cscn1.
What is the InChIKey of (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine?
The InChIKey is SGODPHDIVSDZRQ-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-3-9(12-2)8(10)4-7-5-13-6-11-7/h5-6,8-9H,3-4,10H2,1-2H3/t8-,9-/m1/s1.
What are the key properties of (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine?
(2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine has a molecular weight of 200.31 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-methoxy-1-(1,3-thiazol-4-yl)pentan-2-amine is sourced from PubChem (CID 135132830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).