About (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine
(2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine (PubChem CID 135132848) has the molecular formula C8H13F2N3
and a molecular weight of 189.21 g/mol. Its IUPAC name is (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine.
Molecular Properties
| Compound Name | (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine |
| PubChem CID | 135132848 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine |
| SMILES | CCC(F)(F)[C@H](N)Cn1cccn1 |
| InChI | InChI=1S/C8H13F2N3/c1-2-8(9,10)7(11)6-13-5-3-4-12-13/h3-5,7H,2,6,11H2,1H3/t7-/m1/s1 |
| InChIKey | ABBLGABGFQSUNE-SSDOTTSWSA-N |
| XLogP | 1.26 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine?
The IUPAC name of (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine (CID 135132848) is (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine.
What is the SMILES notation for (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine?
The canonical SMILES for (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine is CCC(F)(F)[C@H](N)Cn1cccn1.
What is the InChIKey of (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine?
The InChIKey is ABBLGABGFQSUNE-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13F2N3/c1-2-8(9,10)7(11)6-13-5-3-4-12-13/h3-5,7H,2,6,11H2,1H3/t7-/m1/s1.
What are the key properties of (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine?
(2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine has a molecular weight of 189.21 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-difluoro-1-pyrazol-1-ylpentan-2-amine is sourced from PubChem (CID 135132848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).