C9H14FN3 — CID 135132893
(2R,3R)-3-fluoro-1-pyrimidin-2-ylpentan-2-amine (PubChem CID 135132893) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is (2R,3R)-3-fluoro-1-pyrimidin-2-ylpentan-2-amine.
| Compound Name | (2R,3R)-3-fluoro-1-pyrimidin-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 135132893 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | (2R,3R)-3-fluoro-1-pyrimidin-2-ylpentan-2-amine |
| SMILES | CC[C@@H](F)[C@H](N)Cc1ncccn1 |
| InChI | InChI=1S/C9H14FN3/c1-2-7(10)8(11)6-9-12-4-3-5-13-9/h3-5,7-8H,2,6,11H2,1H3/t7-,8-/m1/s1 |
| InChIKey | JONJHVYHYBTBQE-HTQZYQBOSA-N |
| XLogP | 1.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |