C17H27FN5O4P — CID 135132989
N'-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-4-fluoro-2-nitrophenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 135132989) has the molecular formula C17H27FN5O4P and a molecular weight of 415.41 g/mol. Its IUPAC name is N'-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-4-fluoro-2-nitrophenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-4-fluoro-2-nitrophenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 135132989 |
| Molecular Formula | C17H27FN5O4P |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N'-[5-[1-[bis(aziridin-1-yl)phosphoryloxy]ethyl]-4-fluoro-2-nitrophenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CC(OP(=O)(N1CC1)N1CC1)c1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H27FN5O4P/c1-13(27-28(26,21-7-8-21)22-9-10-22)14-11-16(20(4)6-5-19(2)3)17(23(24)25)12-15(14)18/h11-13H,5-10H2,1-4H3 |
| InChIKey | RKDPJJHJKSCSRY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|