C8H16N4O — CID 135133067
(2R,3R)-3-methoxy-1-(1,2,4-triazol-1-yl)pentan-2-amine (PubChem CID 135133067) has the molecular formula C8H16N4O and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R,3R)-3-methoxy-1-(1,2,4-triazol-1-yl)pentan-2-amine.
| Compound Name | (2R,3R)-3-methoxy-1-(1,2,4-triazol-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 135133067 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (2R,3R)-3-methoxy-1-(1,2,4-triazol-1-yl)pentan-2-amine |
| SMILES | CC[C@@H](OC)[C@H](N)Cn1cncn1 |
| InChI | InChI=1S/C8H16N4O/c1-3-8(13-2)7(9)4-12-6-10-5-11-12/h5-8H,3-4,9H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | FQWCRUPAZCCMMW-HTQZYQBOSA-N |
| XLogP | 0.03 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |