C31H34F3N3O3 — CID 135134237
(E)-3-[4-[(1R,3R)-6-(1-ethylpyrazol-4-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-1-yl]-3,5-difluoro-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid (PubChem CID 135134237) has the molecular formula C31H34F3N3O3 and a molecular weight of 553.63 g/mol. Its IUPAC name is (E)-3-[4-[(1R,3R)-6-(1-ethylpyrazol-4-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-1-yl]-3,5-difluoro-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(1R,3R)-6-(1-ethylpyrazol-4-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-1-yl]-3,5-difluoro-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135134237 |
| Molecular Formula | C31H34F3N3O3 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | (E)-3-[4-[(1R,3R)-6-(1-ethylpyrazol-4-yl)-2-(2-fluoro-2-methylpropyl)-3-methyl-3,4-dihydro-1H-[1]benzofuro[2,3-c]pyridin-1-yl]-3,5-difluoro-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enoic acid |
| SMILES | CCn1cc(-c2ccc3oc4c(c3c2)C[C@@H](C)N(CC(C)(C)F)[C@@H]4C2(C)C(F)=CC(/C=C/C(=O)O)=CC2F)cn1 |
| InChI | InChI=1S/C31H34F3N3O3/c1-6-36-16-21(15-35-36)20-8-9-24-22(14-20)23-11-18(2)37(17-30(3,4)34)29(28(23)40-24)31(5)25(32)12-19(13-26(31)33)7-10-27(38)39/h7-10,12-16,18,25,29H,6,11,17H2,1-5H3,(H,38,39)/b10-7+/t18-,25?,29+,31?/m1/s1 |
| InChIKey | OTNDMLRKIJHVKW-DRXRILLSSA-N |
| XLogP | 7.13 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|