C29H29N7O4 — CID 135134373
N-[2-[[6,7-dimethoxy-4-(2-phenylethylamino)quinazolin-2-yl]amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 135134373) has the molecular formula C29H29N7O4 and a molecular weight of 539.60 g/mol. Its IUPAC name is N-[2-[[6,7-dimethoxy-4-(2-phenylethylamino)quinazolin-2-yl]amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[[6,7-dimethoxy-4-(2-phenylethylamino)quinazolin-2-yl]amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 135134373 |
| Molecular Formula | C29H29N7O4 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | N-[2-[[6,7-dimethoxy-4-(2-phenylethylamino)quinazolin-2-yl]amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc2nc(NCCNC(=O)c3nnc(-c4ccccc4)o3)nc(NCCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C29H29N7O4/c1-38-23-17-21-22(18-24(23)39-2)33-29(34-25(21)30-14-13-19-9-5-3-6-10-19)32-16-15-31-26(37)28-36-35-27(40-28)20-11-7-4-8-12-20/h3-12,17-18H,13-16H2,1-2H3,(H,31,37)(H2,30,32,33,34) |
| InChIKey | MJDHXLHCXPYLGD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|