C20H34NO3+ — CID 135134407
butyl-ethyl-[2-[4-(methoxymethyl)benzoyl]oxyethyl]-propylazanium (PubChem CID 135134407) has the molecular formula C20H34NO3+ and a molecular weight of 336.50 g/mol. Its IUPAC name is butyl-ethyl-[2-[4-(methoxymethyl)benzoyl]oxyethyl]-propylazanium.
| Compound Name | butyl-ethyl-[2-[4-(methoxymethyl)benzoyl]oxyethyl]-propylazanium |
|---|---|
| PubChem CID | 135134407 |
| Molecular Formula | C20H34NO3+ |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | butyl-ethyl-[2-[4-(methoxymethyl)benzoyl]oxyethyl]-propylazanium |
| SMILES | CCCC[N+](CC)(CCC)CCOC(=O)c1ccc(COC)cc1 |
| InChI | InChI=1S/C20H34NO3/c1-5-8-14-21(7-3,13-6-2)15-16-24-20(22)19-11-9-18(10-12-19)17-23-4/h9-12H,5-8,13-17H2,1-4H3/q+1 |
| InChIKey | ADUKQNBHDTZPBX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|