C30H25N7O4 — CID 135134609
N-[2-[(6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 135134609) has the molecular formula C30H25N7O4 and a molecular weight of 547.58 g/mol. Its IUPAC name is N-[2-[(6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[(6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 135134609 |
| Molecular Formula | C30H25N7O4 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[2-[(6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-yl)amino]ethyl]-5-phenyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc2nc(-c3cccc4cccnc34)nc(NCCNC(=O)c3nnc(-c4ccccc4)o3)c2cc1OC |
| InChI | InChI=1S/C30H25N7O4/c1-39-23-16-21-22(17-24(23)40-2)34-27(20-12-6-10-18-11-7-13-31-25(18)20)35-26(21)32-14-15-33-28(38)30-37-36-29(41-30)19-8-4-3-5-9-19/h3-13,16-17H,14-15H2,1-2H3,(H,33,38)(H,32,34,35) |
| InChIKey | KBNLWFFXVLSZCH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|