C29H25N5O2 — CID 135134611
N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-amine (PubChem CID 135134611) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 135134611 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-2-quinolin-8-ylquinazolin-4-amine |
| SMILES | COc1cc2nc(-c3cccc4cccnc34)nc(NCCc3c[nH]c4ccccc34)c2cc1OC |
| InChI | InChI=1S/C29H25N5O2/c1-35-25-15-22-24(16-26(25)36-2)33-29(21-10-5-7-18-8-6-13-30-27(18)21)34-28(22)31-14-12-19-17-32-23-11-4-3-9-20(19)23/h3-11,13,15-17,32H,12,14H2,1-2H3,(H,31,33,34) |
| InChIKey | ZPKZARZXYQCITD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |