C22H22N6O4 — CID 135134706
N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 135134706) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135134706 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc2nc(NCCNC(=O)c3cc(-c4ccccc4)on3)nc(N)c2cc1OC |
| InChI | InChI=1S/C22H22N6O4/c1-30-18-10-14-15(11-19(18)31-2)26-22(27-20(14)23)25-9-8-24-21(29)16-12-17(32-28-16)13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3,(H,24,29)(H3,23,25,26,27) |
| InChIKey | OQVQWNLJKMJZPF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|