C21H20FN7O4 — CID 135134754
N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(3-fluorophenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 135134754) has the molecular formula C21H20FN7O4 and a molecular weight of 453.43 g/mol. Its IUPAC name is N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(3-fluorophenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(3-fluorophenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 135134754 |
| Molecular Formula | C21H20FN7O4 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(3-fluorophenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc2nc(NCCNC(=O)c3nnc(-c4cccc(F)c4)o3)nc(N)c2cc1OC |
| InChI | InChI=1S/C21H20FN7O4/c1-31-15-9-13-14(10-16(15)32-2)26-21(27-17(13)23)25-7-6-24-18(30)20-29-28-19(33-20)11-4-3-5-12(22)8-11/h3-5,8-10H,6-7H2,1-2H3,(H,24,30)(H3,23,25,26,27) |
| InChIKey | ARSVMFTWZIBDFE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|