About 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine
2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine (PubChem CID 135135288) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine |
| PubChem CID | 135135288 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine |
| SMILES | CC1=CC(CC2CCN(C)C2)=CC(C)N1 |
| InChI | InChI=1S/C13H22N2/c1-10-6-13(7-11(2)14-10)8-12-4-5-15(3)9-12/h6-7,10,12,14H,4-5,8-9H2,1-3H3 |
| InChIKey | APZXVHDMJFUUOB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine?
The IUPAC name of 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine (CID 135135288) is 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine.
What is the SMILES notation for 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine?
The canonical SMILES for 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine is CC1=CC(CC2CCN(C)C2)=CC(C)N1.
What is the InChIKey of 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine?
The InChIKey is APZXVHDMJFUUOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2/c1-10-6-13(7-11(2)14-10)8-12-4-5-15(3)9-12/h6-7,10,12,14H,4-5,8-9H2,1-3H3.
What are the key properties of 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine?
2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine has a molecular weight of 206.33 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-[(1-methylpyrrolidin-3-yl)methyl]-1,2-dihydropyridine is sourced from PubChem (CID 135135288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).