About 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine
3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine (PubChem CID 135135408) has the molecular formula C10H14F2N2
and a molecular weight of 200.23 g/mol. Its IUPAC name is 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine |
| PubChem CID | 135135408 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine |
| SMILES | FC1=CC(F)=C(CC2CCNC2)NC1 |
| InChI | InChI=1S/C10H14F2N2/c11-8-4-9(12)10(14-6-8)3-7-1-2-13-5-7/h4,7,13-14H,1-3,5-6H2 |
| InChIKey | OSKXMCJHSZFWTQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine?
The IUPAC name of 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine (CID 135135408) is 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine.
What is the SMILES notation for 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine?
The canonical SMILES for 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine is FC1=CC(F)=C(CC2CCNC2)NC1.
What is the InChIKey of 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine?
The InChIKey is OSKXMCJHSZFWTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2/c11-8-4-9(12)10(14-6-8)3-7-1-2-13-5-7/h4,7,13-14H,1-3,5-6H2.
What are the key properties of 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine?
3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine has a molecular weight of 200.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-6-(pyrrolidin-3-ylmethyl)-1,2-dihydropyridine is sourced from PubChem (CID 135135408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).