About 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine
6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine (PubChem CID 135135472) has the molecular formula C10H14F3N3
and a molecular weight of 233.24 g/mol. Its IUPAC name is 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine |
| PubChem CID | 135135472 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine |
| SMILES | FC(F)(F)C1=NC=C(CC2CCNC2)NC1 |
| InChI | InChI=1S/C10H14F3N3/c11-10(12,13)9-6-15-8(5-16-9)3-7-1-2-14-4-7/h5,7,14-15H,1-4,6H2 |
| InChIKey | OQJLGBUABYBXCW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine?
The IUPAC name of 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine (CID 135135472) is 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine.
What is the SMILES notation for 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine?
The canonical SMILES for 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine is FC(F)(F)C1=NC=C(CC2CCNC2)NC1.
What is the InChIKey of 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine?
The InChIKey is OQJLGBUABYBXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3/c11-10(12,13)9-6-15-8(5-16-9)3-7-1-2-14-4-7/h5,7,14-15H,1-4,6H2.
What are the key properties of 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine?
6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine has a molecular weight of 233.24 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyrrolidin-3-ylmethyl)-3-(trifluoromethyl)-1,2-dihydropyrazine is sourced from PubChem (CID 135135472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).