C10H15N3 — CID 135135525
2-methyl-6-(pyrrolidin-3-ylmethyl)pyrazine (PubChem CID 135135525) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-6-(pyrrolidin-3-ylmethyl)pyrazine.
| Compound Name | 2-methyl-6-(pyrrolidin-3-ylmethyl)pyrazine |
|---|---|
| PubChem CID | 135135525 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-methyl-6-(pyrrolidin-3-ylmethyl)pyrazine |
| SMILES | Cc1cncc(CC2CCNC2)n1 |
| InChI | InChI=1S/C10H15N3/c1-8-5-12-7-10(13-8)4-9-2-3-11-6-9/h5,7,9,11H,2-4,6H2,1H3 |
| InChIKey | CHEVEMUHVHZZFJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |