C35H41N5O2S — CID 135135898
5-[(1R)-2-[(Z)-1-amino-2-(methylamino)ethenyl]cyclopropyl]-1-[3-[[hexyl-(3-phenylphenyl)sulfanylamino]methyl]phenyl]pyrazole-4-carboxylic acid (PubChem CID 135135898) has the molecular formula C35H41N5O2S and a molecular weight of 595.81 g/mol. Its IUPAC name is 5-[(1R)-2-[(Z)-1-amino-2-(methylamino)ethenyl]cyclopropyl]-1-[3-[[hexyl-(3-phenylphenyl)sulfanylamino]methyl]phenyl]pyrazole-4-carboxylic acid.
| Compound Name | 5-[(1R)-2-[(Z)-1-amino-2-(methylamino)ethenyl]cyclopropyl]-1-[3-[[hexyl-(3-phenylphenyl)sulfanylamino]methyl]phenyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135135898 |
| Molecular Formula | C35H41N5O2S |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 5-[(1R)-2-[(Z)-1-amino-2-(methylamino)ethenyl]cyclopropyl]-1-[3-[[hexyl-(3-phenylphenyl)sulfanylamino]methyl]phenyl]pyrazole-4-carboxylic acid |
| SMILES | CCCCCCN(Cc1cccc(-n2ncc(C(=O)O)c2[C@@H]2CC2/C(N)=C/NC)c1)Sc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C35H41N5O2S/c1-3-4-5-9-18-39(43-29-17-11-15-27(20-29)26-13-7-6-8-14-26)24-25-12-10-16-28(19-25)40-34(32(22-38-40)35(41)42)31-21-30(31)33(36)23-37-2/h6-8,10-17,19-20,22-23,30-31,37H,3-5,9,18,21,24,36H2,1-2H3,(H,41,42)/b33-23-/t30?,31-/m1/s1 |
| InChIKey | LSJDLFDZUIVDHK-PGIIJWHMSA-N |
| XLogP | 7.45 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|