About methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate
methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate (PubChem CID 135136068) has the molecular formula C16H22F2N2O2
and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate |
| PubChem CID | 135136068 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate |
| SMILES | CC/C(C)=C/c1cnc(C(=O)OC)cc1N(C)CC(C)(F)F |
| InChI | InChI=1S/C16H22F2N2O2/c1-6-11(2)7-12-9-19-13(15(21)22-5)8-14(12)20(4)10-16(3,17)18/h7-9H,6,10H2,1-5H3/b11-7+ |
| InChIKey | IKHFWYRDYPGGSA-YRNVUSSQSA-N |
| XLogP | 3.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate?
The IUPAC name of methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate (CID 135136068) is methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate.
What is the SMILES notation for methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate?
The canonical SMILES for methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate is CC/C(C)=C/c1cnc(C(=O)OC)cc1N(C)CC(C)(F)F.
What is the InChIKey of methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate?
The InChIKey is IKHFWYRDYPGGSA-YRNVUSSQSA-N. The full InChI is InChI=1S/C16H22F2N2O2/c1-6-11(2)7-12-9-19-13(15(21)22-5)8-14(12)20(4)10-16(3,17)18/h7-9H,6,10H2,1-5H3/b11-7+.
What are the key properties of methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate?
methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate has a molecular weight of 312.36 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2,2-difluoropropyl(methyl)amino]-5-[(E)-2-methylbut-1-enyl]pyridine-2-carboxylate is sourced from PubChem (CID 135136068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).