About 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine
1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine (PubChem CID 135136377) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine |
| PubChem CID | 135136377 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)C1=CC(C)(N)C=CN=C1 |
| InChI | InChI=1S/C10H18N4/c1-10(11)4-5-14-7-8(6-10)9(12-2)13-3/h4-7,9,12-13H,11H2,1-3H3 |
| InChIKey | NYCZZWHIAOXTOG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine?
The IUPAC name of 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine (CID 135136377) is 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine.
What is the SMILES notation for 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine?
The canonical SMILES for 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine is CNC(NC)C1=CC(C)(N)C=CN=C1.
What is the InChIKey of 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine?
The InChIKey is NYCZZWHIAOXTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c1-10(11)4-5-14-7-8(6-10)9(12-2)13-3/h4-7,9,12-13H,11H2,1-3H3.
What are the key properties of 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine?
1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine has a molecular weight of 194.28 g/mol, XLogP of -0.01, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-5-methylazepin-3-yl)-N,N'-dimethylmethanediamine is sourced from PubChem (CID 135136377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).