C13H21NO2S — CID 135136567
6-methyl-7-[(1Z,3E)-4-methylhexa-1,3-dienyl]-2,3,4,5-tetrahydrothiazepine 1,1-dioxide (PubChem CID 135136567) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 6-methyl-7-[(1Z,3E)-4-methylhexa-1,3-dienyl]-2,3,4,5-tetrahydrothiazepine 1,1-dioxide.
| Compound Name | 6-methyl-7-[(1Z,3E)-4-methylhexa-1,3-dienyl]-2,3,4,5-tetrahydrothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 135136567 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 6-methyl-7-[(1Z,3E)-4-methylhexa-1,3-dienyl]-2,3,4,5-tetrahydrothiazepine 1,1-dioxide |
| SMILES | CC/C(C)=C/C=C\C1=C(C)CCCNS1(=O)=O |
| InChI | InChI=1S/C13H21NO2S/c1-4-11(2)7-5-9-13-12(3)8-6-10-14-17(13,15)16/h5,7,9,14H,4,6,8,10H2,1-3H3/b9-5-,11-7+ |
| InChIKey | IWVBLOHDDSPLRK-KGAZIEBHSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|