C23H27N3O3 — CID 135136749
methyl 3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate (PubChem CID 135136749) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl 3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate.
| Compound Name | methyl 3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
|---|---|
| PubChem CID | 135136749 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | methyl 3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-2,2-dimethyl-3-(3-oxo-1,2-dihydroinden-5-yl)propanoate |
| SMILES | [H]/N=N/c1c(NC)ccc(C(c2ccc3c(c2)C(=O)CC3)C(C)(C)C(=O)OC)c1C |
| InChI | InChI=1S/C23H27N3O3/c1-13-16(9-10-18(25-4)21(13)26-24)20(23(2,3)22(28)29-5)15-7-6-14-8-11-19(27)17(14)12-15/h6-7,9-10,12,20,24-25H,8,11H2,1-5H3/b26-24+ |
| InChIKey | AJYIIWZEJWRKAX-SHHOIMCASA-N |
| XLogP | 5.16 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|