C26H30INO6S — CID 135136813
methyl (3S)-3-iodo-2,2-dimethyl-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-prop-2-ynoxypropanoate (PubChem CID 135136813) has the molecular formula C26H30INO6S and a molecular weight of 611.50 g/mol. Its IUPAC name is methyl (3S)-3-iodo-2,2-dimethyl-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-prop-2-ynoxypropanoate.
| Compound Name | methyl (3S)-3-iodo-2,2-dimethyl-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-prop-2-ynoxypropanoate |
|---|---|
| PubChem CID | 135136813 |
| Molecular Formula | C26H30INO6S |
| Molecular Weight | 611.50 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | methyl (3S)-3-iodo-2,2-dimethyl-3-[4-methyl-3-[[(4R)-4-methyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]phenyl]-3-prop-2-ynoxypropanoate |
| SMILES | C#CCO[C@](I)(c1ccc(C)c(CN2C[C@@H](C)Oc3ccccc3S2(=O)=O)c1)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C26H30INO6S/c1-7-14-33-26(27,25(4,5)24(29)32-6)21-13-12-18(2)20(15-21)17-28-16-19(3)34-22-10-8-9-11-23(22)35(28,30)31/h1,8-13,15,19H,14,16-17H2,2-6H3/t19-,26-/m1/s1 |
| InChIKey | MWYIBFALJMPHPG-NIYFSFCBSA-N |
| XLogP | 4.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|