C24H20N2O — CID 1351369
N-(2,6-dimethylphenyl)-2-phenylquinoline-4-carboxamide (PubChem CID 1351369) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 1351369 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C24H20N2O/c1-16-9-8-10-17(2)23(16)26-24(27)20-15-22(18-11-4-3-5-12-18)25-21-14-7-6-13-19(20)21/h3-15H,1-2H3,(H,26,27) |
| InChIKey | AKCQWCNDUPKMFE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |