About [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea
[(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea (PubChem CID 135137349) has the molecular formula C15H20F2N2S
and a molecular weight of 298.40 g/mol. Its IUPAC name is [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea.
Molecular Properties
| Compound Name | [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea |
| PubChem CID | 135137349 |
| Molecular Formula | C15H20F2N2S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea |
| SMILES | CCCc1ccc(F)c(/C(NC(N)=S)=C(/C)CC)c1F |
| InChI | InChI=1S/C15H20F2N2S/c1-4-6-10-7-8-11(16)12(13(10)17)14(9(3)5-2)19-15(18)20/h7-8H,4-6H2,1-3H3,(H3,18,19,20)/b14-9+ |
| InChIKey | FPKFWCCDMUZBID-NTEUORMPSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea?
The IUPAC name of [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea (CID 135137349) is [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea.
What is the SMILES notation for [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea?
The canonical SMILES for [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea is CCCc1ccc(F)c(/C(NC(N)=S)=C(/C)CC)c1F.
What is the InChIKey of [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea?
The InChIKey is FPKFWCCDMUZBID-NTEUORMPSA-N. The full InChI is InChI=1S/C15H20F2N2S/c1-4-6-10-7-8-11(16)12(13(10)17)14(9(3)5-2)19-15(18)20/h7-8H,4-6H2,1-3H3,(H3,18,19,20)/b14-9+.
What are the key properties of [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea?
[(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea has a molecular weight of 298.40 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(2,6-difluoro-3-propylphenyl)-2-methylbut-1-enyl]thiourea is sourced from PubChem (CID 135137349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).