About 4-chloro-2,3-dimethylbutan-1-imine
4-chloro-2,3-dimethylbutan-1-imine (PubChem CID 135137361) has the molecular formula C6H12ClN
and a molecular weight of 133.62 g/mol. Its IUPAC name is 4-chloro-2,3-dimethylbutan-1-imine.
Molecular Properties
| Compound Name | 4-chloro-2,3-dimethylbutan-1-imine |
| PubChem CID | 135137361 |
| Molecular Formula | C6H12ClN |
| Molecular Weight | 133.62 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4-chloro-2,3-dimethylbutan-1-imine |
| SMILES | [H]/N=C/C(C)C(C)CCl |
| InChI | InChI=1S/C6H12ClN/c1-5(3-7)6(2)4-8/h4-6,8H,3H2,1-2H3/b8-4+ |
| InChIKey | GNWRZGMADPZDBE-XBXARRHUSA-N |
| XLogP | 2.15 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,3-dimethylbutan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,3-dimethylbutan-1-imine?
The IUPAC name of 4-chloro-2,3-dimethylbutan-1-imine (CID 135137361) is 4-chloro-2,3-dimethylbutan-1-imine.
What is the SMILES notation for 4-chloro-2,3-dimethylbutan-1-imine?
The canonical SMILES for 4-chloro-2,3-dimethylbutan-1-imine is [H]/N=C/C(C)C(C)CCl.
What is the InChIKey of 4-chloro-2,3-dimethylbutan-1-imine?
The InChIKey is GNWRZGMADPZDBE-XBXARRHUSA-N. The full InChI is InChI=1S/C6H12ClN/c1-5(3-7)6(2)4-8/h4-6,8H,3H2,1-2H3/b8-4+.
What are the key properties of 4-chloro-2,3-dimethylbutan-1-imine?
4-chloro-2,3-dimethylbutan-1-imine has a molecular weight of 133.62 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,3-dimethylbutan-1-imine is sourced from PubChem (CID 135137361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).