C33H41F4N5O4 — CID 135137398
(2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl-methylamino]propoxy]ethoxy]propanoate (PubChem CID 135137398) has the molecular formula C33H41F4N5O4 and a molecular weight of 647.71 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl-methylamino]propoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl-methylamino]propoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 135137398 |
| Molecular Formula | C33H41F4N5O4 |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl-methylamino]propoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCN(C)CCCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H41F4N5O4/c1-3-4-12-26-40-30-31(22-10-5-6-11-25(22)39-33(30)38)42(26)16-8-7-14-41(2)15-9-17-44-19-20-45-18-13-27(43)46-32-28(36)23(34)21-24(35)29(32)37/h5-6,10-11,21H,3-4,7-9,12-20H2,1-2H3,(H2,38,39) |
| InChIKey | ZZFZJKGQXNSUPI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|