C22H23F2N3O3 — CID 135138357
5-[5-[3-[(3Z,5Z)-5-(3,3-difluorocyclobutyl)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one (PubChem CID 135138357) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is 5-[5-[3-[(3Z,5Z)-5-(3,3-difluorocyclobutyl)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[5-[3-[(3Z,5Z)-5-(3,3-difluorocyclobutyl)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 135138357 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-[5-[3-[(3Z,5Z)-5-(3,3-difluorocyclobutyl)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
| SMILES | C=C(/C=C\C(=C/C)C1CC(F)(F)C1)C1CC(Oc2cnc(-c3cc(=O)[nH]o3)cn2)C1 |
| InChI | InChI=1S/C22H23F2N3O3/c1-3-14(16-9-22(23,24)10-16)5-4-13(2)15-6-17(7-15)29-21-12-25-18(11-26-21)19-8-20(28)27-30-19/h3-5,8,11-12,15-17H,2,6-7,9-10H2,1H3,(H,27,28)/b5-4-,14-3+ |
| InChIKey | NJZMOPWVAMJFPI-QVQLBOQVSA-N |
| XLogP | 4.69 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|