C23H29N3O3 — CID 135138423
methyl (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-(3-hydroxy-2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoate (PubChem CID 135138423) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is methyl (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-(3-hydroxy-2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-(3-hydroxy-2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135138423 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | methyl (3S)-3-[3-diazenyl-2-methyl-4-(methylamino)phenyl]-3-(3-hydroxy-2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoate |
| SMILES | [H]/N=N/c1c(NC)ccc([C@H](c2ccc3c(c2)C(O)CC3)C(C)(C)C(=O)OC)c1C |
| InChI | InChI=1S/C23H29N3O3/c1-13-16(9-10-18(25-4)21(13)26-24)20(23(2,3)22(28)29-5)15-7-6-14-8-11-19(27)17(14)12-15/h6-7,9-10,12,19-20,24-25,27H,8,11H2,1-5H3/b26-24+/t19?,20-/m0/s1 |
| InChIKey | AOWBVTNGZXNTDQ-OMQCCQNQSA-N |
| XLogP | 5.01 |
| TPSA | 94.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|