C22H37NO — CID 135138744
(3E)-1-cyclohexyl-6-(cyclohexylamino)-3,5,5-trimethylhepta-3,6-dien-2-one (PubChem CID 135138744) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is (3E)-1-cyclohexyl-6-(cyclohexylamino)-3,5,5-trimethylhepta-3,6-dien-2-one.
| Compound Name | (3E)-1-cyclohexyl-6-(cyclohexylamino)-3,5,5-trimethylhepta-3,6-dien-2-one |
|---|---|
| PubChem CID | 135138744 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | (3E)-1-cyclohexyl-6-(cyclohexylamino)-3,5,5-trimethylhepta-3,6-dien-2-one |
| SMILES | C=C(NC1CCCCC1)C(C)(C)/C=C(\C)C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C22H37NO/c1-17(21(24)15-19-11-7-5-8-12-19)16-22(3,4)18(2)23-20-13-9-6-10-14-20/h16,19-20,23H,2,5-15H2,1,3-4H3/b17-16+ |
| InChIKey | NKZQBUWUGDGUAB-WUKNDPDISA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|