About 3-propyl-4,5-dihydro-1H-pyrazol-5-ol
3-propyl-4,5-dihydro-1H-pyrazol-5-ol (PubChem CID 135138749) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-propyl-4,5-dihydro-1H-pyrazol-5-ol.
Molecular Properties
| Compound Name | 3-propyl-4,5-dihydro-1H-pyrazol-5-ol |
| PubChem CID | 135138749 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 3-propyl-4,5-dihydro-1H-pyrazol-5-ol |
| SMILES | CCCC1=NNC(O)C1 |
| InChI | InChI=1S/C6H12N2O/c1-2-3-5-4-6(9)8-7-5/h6,8-9H,2-4H2,1H3 |
| InChIKey | VTWDSDKPMSRARJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propyl-4,5-dihydro-1H-pyrazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-4,5-dihydro-1H-pyrazol-5-ol?
The IUPAC name of 3-propyl-4,5-dihydro-1H-pyrazol-5-ol (CID 135138749) is 3-propyl-4,5-dihydro-1H-pyrazol-5-ol.
What is the SMILES notation for 3-propyl-4,5-dihydro-1H-pyrazol-5-ol?
The canonical SMILES for 3-propyl-4,5-dihydro-1H-pyrazol-5-ol is CCCC1=NNC(O)C1.
What is the InChIKey of 3-propyl-4,5-dihydro-1H-pyrazol-5-ol?
The InChIKey is VTWDSDKPMSRARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-2-3-5-4-6(9)8-7-5/h6,8-9H,2-4H2,1H3.
What are the key properties of 3-propyl-4,5-dihydro-1H-pyrazol-5-ol?
3-propyl-4,5-dihydro-1H-pyrazol-5-ol has a molecular weight of 128.17 g/mol, XLogP of 0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-4,5-dihydro-1H-pyrazol-5-ol is sourced from PubChem (CID 135138749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).