About 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one
5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one (PubChem CID 135138797) has the molecular formula C17H12ClF2N3O3
and a molecular weight of 379.75 g/mol. Its IUPAC name is 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
| PubChem CID | 135138797 |
| Molecular Formula | C17H12ClF2N3O3 |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc(-c2cnc(OC3CC(c4cc(F)c(Cl)c(F)c4)C3)cn2)o[nH]1 |
| InChI | InChI=1S/C17H12ClF2N3O3/c18-17-11(19)3-9(4-12(17)20)8-1-10(2-8)25-16-7-21-13(6-22-16)14-5-15(24)23-26-14/h3-8,10H,1-2H2,(H,23,24) |
| InChIKey | AHDBYDKGGSXTOY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one?
The IUPAC name of 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one (CID 135138797) is 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one is O=c1cc(-c2cnc(OC3CC(c4cc(F)c(Cl)c(F)c4)C3)cn2)o[nH]1.
What is the InChIKey of 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one?
The InChIKey is AHDBYDKGGSXTOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClF2N3O3/c18-17-11(19)3-9(4-12(17)20)8-1-10(2-8)25-16-7-21-13(6-22-16)14-5-15(24)23-26-14/h3-8,10H,1-2H2,(H,23,24).
What are the key properties of 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one?
5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one has a molecular weight of 379.75 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[3-(4-chloro-3,5-difluorophenyl)cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one is sourced from PubChem (CID 135138797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).