C20H20F3N3O4 — CID 135138833
5-[5-[3-[(3Z)-6-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one (PubChem CID 135138833) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is 5-[5-[3-[(3Z)-6-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[5-[3-[(3Z)-6-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 135138833 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-[5-[3-[(3Z)-6-methyl-5-(trifluoromethoxy)hepta-1,3,5-trien-2-yl]cyclobutyl]oxypyrazin-2-yl]-1,2-oxazol-3-one |
| SMILES | C=C(/C=C\C(OC(F)(F)F)=C(C)C)C1CC(Oc2cnc(-c3cc(=O)[nH]o3)cn2)C1 |
| InChI | InChI=1S/C20H20F3N3O4/c1-11(2)16(29-20(21,22)23)5-4-12(3)13-6-14(7-13)28-19-10-24-15(9-25-19)17-8-18(27)26-30-17/h4-5,8-10,13-14H,3,6-7H2,1-2H3,(H,26,27)/b5-4- |
| InChIKey | AHBCQUDIRLOYCV-PLNGDYQASA-N |
| XLogP | 4.53 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|