C27H41N5O — CID 135138862
4-[[5-[1-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethylpropyl]-2-methylphenyl]methyl]-1-methyl-1,4-diazepan-2-one (PubChem CID 135138862) has the molecular formula C27H41N5O and a molecular weight of 451.66 g/mol. Its IUPAC name is 4-[[5-[1-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethylpropyl]-2-methylphenyl]methyl]-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-[[5-[1-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethylpropyl]-2-methylphenyl]methyl]-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 135138862 |
| Molecular Formula | C27H41N5O |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | 4-[[5-[1-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethylpropyl]-2-methylphenyl]methyl]-1-methyl-1,4-diazepan-2-one |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C)cc1CN1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C27H41N5O/c1-18-9-10-20(15-21(18)16-32-14-8-13-30(6)24(33)17-32)25(27(3,4)5)22-11-12-23(31(7)29)26(28)19(22)2/h9-12,15,25H,8,13-14,16-17,28-29H2,1-7H3 |
| InChIKey | OCTHXNVMPKBBGL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|