C27H39N5O3 — CID 135138869
3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid (PubChem CID 135138869) has the molecular formula C27H39N5O3 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135138869 |
| Molecular Formula | C27H39N5O3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[4-methyl-3-[(4-methyl-3-oxo-1,4-diazepan-1-yl)methyl]phenyl]propanoic acid |
| SMILES | Cc1ccc(C(c2ccc(N(C)N)c(N)c2C)C(C)(C)C(=O)O)cc1CN1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C27H39N5O3/c1-17-8-9-19(14-20(17)15-32-13-7-12-30(5)23(33)16-32)24(27(3,4)26(34)35)21-10-11-22(31(6)29)25(28)18(21)2/h8-11,14,24H,7,12-13,15-16,28-29H2,1-6H3,(H,34,35) |
| InChIKey | KGEULSIBHDKJCY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|