C22H30N2O — CID 135138939
6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol (PubChem CID 135138939) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 135138939 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 6-[1-[3-amino-2-methyl-4-(methylamino)phenyl]-2,2-dimethylpropyl]-2,3-dihydro-1H-inden-1-ol |
| SMILES | CNc1ccc(C(c2ccc3c(c2)C(O)CC3)C(C)(C)C)c(C)c1N |
| InChI | InChI=1S/C22H30N2O/c1-13-16(9-10-18(24-5)21(13)23)20(22(2,3)4)15-7-6-14-8-11-19(25)17(14)12-15/h6-7,9-10,12,19-20,24-25H,8,11,23H2,1-5H3 |
| InChIKey | ZZOYBMCYMPSSRH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|