About undecan-6-yl 2-(methylamino)acetate
undecan-6-yl 2-(methylamino)acetate (PubChem CID 135139014) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is undecan-6-yl 2-(methylamino)acetate.
Molecular Properties
| Compound Name | undecan-6-yl 2-(methylamino)acetate |
| PubChem CID | 135139014 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | undecan-6-yl 2-(methylamino)acetate |
| SMILES | CCCCCC(CCCCC)OC(=O)CNC |
| InChI | InChI=1S/C14H29NO2/c1-4-6-8-10-13(11-9-7-5-2)17-14(16)12-15-3/h13,15H,4-12H2,1-3H3 |
| InChIKey | NOODYOXAGHWMQO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-6-yl 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-6-yl 2-(methylamino)acetate?
The IUPAC name of undecan-6-yl 2-(methylamino)acetate (CID 135139014) is undecan-6-yl 2-(methylamino)acetate.
What is the SMILES notation for undecan-6-yl 2-(methylamino)acetate?
The canonical SMILES for undecan-6-yl 2-(methylamino)acetate is CCCCCC(CCCCC)OC(=O)CNC.
What is the InChIKey of undecan-6-yl 2-(methylamino)acetate?
The InChIKey is NOODYOXAGHWMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO2/c1-4-6-8-10-13(11-9-7-5-2)17-14(16)12-15-3/h13,15H,4-12H2,1-3H3.
What are the key properties of undecan-6-yl 2-(methylamino)acetate?
undecan-6-yl 2-(methylamino)acetate has a molecular weight of 243.39 g/mol, XLogP of 3.28, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-6-yl 2-(methylamino)acetate is sourced from PubChem (CID 135139014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).